3,4-Dimethoxynitrobenzene structure
|
Common Name | 3,4-Dimethoxynitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 709-09-1 | Molecular Weight | 183.16100 | |
| Density | 1.226 g/cm3 | Boiling Point | 230 °C17 mm Hg(lit.) | |
| Molecular Formula | C8H9NO4 | Melting Point | 95-98 °C(lit.) | |
| MSDS | N/A | Flash Point | 221-223°C/10mm | |
| Name | 4-Nitroveratrole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226 g/cm3 |
|---|---|
| Boiling Point | 230 °C17 mm Hg(lit.) |
| Melting Point | 95-98 °C(lit.) |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16100 |
| Flash Point | 221-223°C/10mm |
| Exact Mass | 183.05300 |
| PSA | 64.28000 |
| LogP | 2.13520 |
| Index of Refraction | 1.645 |
| InChIKey | YFWBUVZWCBFSQN-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])cc1OC |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 211-906-2 |
| MFCD00007238 |
| 3,4-Dimethoxynitrobenzene |