m-Hemipic acid
m-Hemipic acid structure
|
Common Name | m-Hemipic acid | ||
|---|---|---|---|---|
| CAS Number | 577-68-4 | Molecular Weight | 226.18300 | |
| Density | 1.391g/cm3 | Boiling Point | 394.7ºC at 760 mmHg | |
| Molecular Formula | C10H10O6 | Melting Point | 179 °C | |
| MSDS | N/A | Flash Point | 157.1ºC | |
Summary: 4,5-dimethoxyphthalic acid (m-Hemipic acid, CAS: 577-68-4) is a solid with a molecular formula of C10H10O6 and a molecular weight of 226.18300. The compound appears as a solid, with a melting point of 179 °C, boiling point of 394.7ºC at 760 mmHg, and a density of 1.391g/cm3. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,5-dimethoxyphthalic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.391g/cm3 |
|---|---|
| Boiling Point | 394.7ºC at 760 mmHg |
| Melting Point | 179 °C |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18300 |
| Flash Point | 157.1ºC |
| Exact Mass | 226.04800 |
| PSA | 93.06000 |
| LogP | 1.10020 |
| Index of Refraction | 1.572 |
| InChIKey | SKBDLRWFSRLIPP-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)c(C(=O)O)cc1OC |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 10 | |
CAS#:531-88-4
CAS#:7721-62-2
CAS#:494-99-5
CAS#:93-07-2
CAS#:408534-24-7
CAS#:17078-61-4
CAS#:66323-03-3
CAS#:66323-02-2
CAS#:58-74-2
CAS#:483-18-1
CAS#:120-80-9
CAS#:99-50-3
CAS#:124-38-9
CAS#:3395-03-7
CAS#:17418-07-4
CAS#:78219-03-1
CAS#:43073-12-7
CAS#:63035-28-9
CAS#:63958-66-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| meta-hemipinic acid |
| 2-carboxy-4,5-dimethoxybenzoic acid |
| m-Hemipinic acid |
| 4,5-dimethoxybenzene-1,2-dicarboxylic acid |
| Phthalic acid,5-dimethoxy |
| 1,4,5-dimethoxy |
| 4,5-Dimethoxy-1,2-benzoldicarbonsaeure |
| m-Hemipic acid |
| m-opianic acid |
| 4,5-dimethoxy-phthalic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4,5-dimethoxyphthalic acid have? |
| A: English synonyms of 4,5-dimethoxyphthalic acid: meta-hemipinic acid, 2-carboxy-4,5-dimethoxybenzoic acid, m-Hemipinic acid, 4,5-dimethoxybenzene-1,2-dicarboxylic acid, Phthalic acid,5-dimethoxy, 1,4,5-dimethoxy, 4,5-Dimethoxy-1,2-benzoldicarbonsaeure, m-Hemipic acid, m-opianic acid, 4,5-dimethoxy-phthalic acid. |
| Q: What is the polar surface area (PSA) of 4,5-dimethoxyphthalic acid? |
| A: Polar surface area (PSA) of 4,5-dimethoxyphthalic acid is 93.06000. |
| Q: What are the downstream products of 4,5-dimethoxyphthalic acid? |
| A: Related downstream products(CAS) of 4,5-dimethoxyphthalic acid: 120-80-9;99-50-3;124-38-9;3395-03-7;17078-61-4;17418-07-4;78219-03-1;43073-12-7;63035-28-9;63958-66-7. |
| Q: What is the English name of 4,5-dimethoxyphthalic acid? |
| A: The English name of 4,5-dimethoxyphthalic acid is 4,5-dimethoxyphthalic acid. |
| Q: What is the melting point of 4,5-dimethoxyphthalic acid? |
| A: Melting point of 4,5-dimethoxyphthalic acid is 179 °C. |
| Q: What is the CAS number of 4,5-dimethoxyphthalic acid? |
| A: CAS number of 4,5-dimethoxyphthalic acid is 577-68-4. |
| Q: What is the molecular weight of 4,5-dimethoxyphthalic acid? |
| A: Molecular weight of 4,5-dimethoxyphthalic acid is 226.18300. |
| Q: What is the boiling point of 4,5-dimethoxyphthalic acid? |
| A: Boiling point of 4,5-dimethoxyphthalic acid is 394.7ºC at 760 mmHg. |
| Q: What is the SMILES notation of 4,5-dimethoxyphthalic acid? |
| A: SMILES notation of 4,5-dimethoxyphthalic acid is COc1cc(C(=O)O)c(C(=O)O)cc1OC. |
| Q: What is the molecular formula of 4,5-dimethoxyphthalic acid? |
| A: Molecular formula of 4,5-dimethoxyphthalic acid is C10H10O6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |