Thalidomide-O-amido-CH2-PEG3-CH2-NH-Boc structure
|
Common Name | Thalidomide-O-amido-CH2-PEG3-CH2-NH-Boc | ||
|---|---|---|---|---|
| CAS Number | 1799711-31-1 | Molecular Weight | 634.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H42N4O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide-O-amido-CH2-PEG3-CH2-NH-BocThalidomide-O-amido-CH2-PEG3-CH2-NH-Boc is a synthesized E3 ligase ligand-linker conjugate. Thalidomide-O-amido-CH2-PEG3-CH2-NH-Boc incorporates the Thalidomide based cereblon ligand and a linker. Thalidomide-O-amido-CH2-PEG3-CH2-NH-Boc can be used for the synthesis of PROTAC BET degrader[1]. (From patent WO2017180417A1 compound s7). |
| Name | Thalidomide-O-amido-CH2-PEG3-CH2-NH-Boc |
|---|
| Description | Thalidomide-O-amido-CH2-PEG3-CH2-NH-Boc is a synthesized E3 ligase ligand-linker conjugate. Thalidomide-O-amido-CH2-PEG3-CH2-NH-Boc incorporates the Thalidomide based cereblon ligand and a linker. Thalidomide-O-amido-CH2-PEG3-CH2-NH-Boc can be used for the synthesis of PROTAC BET degrader[1]. (From patent WO2017180417A1 compound s7). |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| References |
[1]. Shaomeng Wang, et al. Bet protein degraders. WO2017180417A1. |
| Molecular Formula | C30H42N4O11 |
|---|---|
| Molecular Weight | 634.67 |
| InChIKey | GUERDSNOMPTZOW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCOCCOCCOCCCNC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |