ER 50891 structure
|
Common Name | ER 50891 | ||
|---|---|---|---|---|
| CAS Number | 187400-85-7 | Molecular Weight | 432.51300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ER 50891ER-50891 is a potent antagonist of retinoic acid receptor α(RARα). ER-50891 significantly attenuates ATRA's inhibitive effects on BMP 2-induced osteoblastogenesis[1]. |
| Name | 4-[5-(8-Isopropyl-4-phenyl-2-quinolinyl)-1H-pyrrol-2-yl]benzoic a cid |
|---|
| Description | ER-50891 is a potent antagonist of retinoic acid receptor α(RARα). ER-50891 significantly attenuates ATRA's inhibitive effects on BMP 2-induced osteoblastogenesis[1]. |
|---|---|
| Related Catalog | |
| Target |
RARα[1] |
| References |
| Molecular Formula | C29H24N2O2 |
|---|---|
| Molecular Weight | 432.51300 |
| Exact Mass | 432.18400 |
| PSA | 65.98000 |
| LogP | 7.38550 |
| InChIKey | LSGNKLDHMQVTEK-UHFFFAOYSA-N |
| SMILES | CC(C)c1cccc2c(-c3ccccc3)cc(-c3ccc(-c4ccc(C(=O)O)cc4)[nH]3)nc12 |