NIR-641 N-succinimidyl ester structure
|
Common Name | NIR-641 N-succinimidyl ester | ||
|---|---|---|---|---|
| CAS Number | 190714-26-2 | Molecular Weight | 630.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H44ClN3O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of NIR-641 N-succinimidyl esterNIR-641 N-succinimidyl ester is a fluorescent dye[1]. |
| Name | NIR-641 N-succinimidyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | NIR-641 N-succinimidyl ester is a fluorescent dye[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C37H44ClN3O4 |
|---|---|
| Molecular Weight | 630.21600 |
| Exact Mass | 629.30200 |
| PSA | 69.93000 |
| LogP | 4.01010 |
| InChIKey | QNVXMFIPFKQFIP-UHFFFAOYSA-M |
| SMILES | CCN1C(=CC=CC=CC2=[N+](CCCCCC(=O)ON3C(=O)CCC3=O)c3ccccc3C2(C)C)C(C)(C)c2ccccc21.[Cl-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
| (2,5-dioxopyrrolidin-1-yl) 6-[2-[(1E,3E,5Z)-5-(1-ethyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanoate,chloride |