GGTI-2133-d7 structure
|
Common Name | GGTI-2133-d7 | ||
|---|---|---|---|---|
| CAS Number | 191102-79-1 | Molecular Weight | 456.53622 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H28N4O3 | Melting Point | 103-118.5 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of GGTI-2133-d7GGTI-2133 is a direct and selective inhibitor of geran ylgeranyltransferase (GGTase). GGTI-2133 has the potential for eosinophilic airway inflammation such as asthma research[1]. |
| Name | GGTI 2133 |
|---|
| Description | GGTI-2133 is a direct and selective inhibitor of geran ylgeranyltransferase (GGTase). GGTI-2133 has the potential for eosinophilic airway inflammation such as asthma research[1]. |
|---|---|
| Related Catalog | |
| Target |
Geran ylgeranyltransferase (GGTase) |
| Melting Point | 103-118.5 °C |
|---|---|
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.53622 |
| Appearance of Characters | solid |
| InChIKey | ODTFPKNIFYMEHP-VWLOTQADSA-N |
| SMILES | CC(C)CC(NC(=O)c1ccc(NCc2cnc[nH]2)cc1-c1cccc2ccccc12)C(=O)O |
| Storage condition | −20°C |