Thalidomide-O-C10-NH2 structure
|
Common Name | Thalidomide-O-C10-NH2 | ||
|---|---|---|---|---|
| CAS Number | 1957236-08-6 | Molecular Weight | 429.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H31N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide-O-C10-NH2Thalidomide-O-C10-NH2 is a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide based cereblon ligand and a linker used in PROTAC technology[1]. |
| Name | Thalidomide-O-C10-NH2 |
|---|
| Description | Thalidomide-O-C10-NH2 is a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide based cereblon ligand and a linker used in PROTAC technology[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[2]. |
| References |
| Molecular Formula | C23H31N3O5 |
|---|---|
| Molecular Weight | 429.51 |
| InChIKey | GYCOQQKBPGDRKH-UHFFFAOYSA-N |
| SMILES | NCCCCCCCCCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Hazard Codes | Xi |
|---|