Thalidomide-O-C4-NH2 hydrochloride structure
|
Common Name | Thalidomide-O-C4-NH2 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2376990-29-1 | Molecular Weight | 381.81 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20ClN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide-O-C4-NH2 hydrochlorideThalidomide-O-C4-NH2 hydrochloride is a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide (HY-14658) based cereblon ligand and a linker used in PROTAC technology. |
| Name | Thalidomide-O-C4-NH2 hydrochloride |
|---|
| Description | Thalidomide-O-C4-NH2 hydrochloride is a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide (HY-14658) based cereblon ligand and a linker used in PROTAC technology. |
|---|---|
| Related Catalog | |
| Target |
VHL |
| Molecular Formula | C17H20ClN3O5 |
|---|---|
| Molecular Weight | 381.81 |
| InChIKey | VRXZGWPQXJYEPH-UHFFFAOYSA-N |
| SMILES | Cl.NCCCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Hazard Codes | Xi |
|---|