Thalidomide-O-C6-NH2 hydrochloride structure
|
Common Name | Thalidomide-O-C6-NH2 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2245697-88-3 | Molecular Weight | 409.86 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24ClN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide-O-C6-NH2 hydrochlorideThalidomide-O-C6-NH2 hydrochloride is a synthesized E3 ligase ligand-linker conjugate used in the PROTAC dTAG-13, a degrader of FKBP12F36V and BET[1]. |
| Name | Thalidomide-O-C6-NH2 hydrochloride |
|---|
| Description | Thalidomide-O-C6-NH2 hydrochloride is a synthesized E3 ligase ligand-linker conjugate used in the PROTAC dTAG-13, a degrader of FKBP12F36V and BET[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H24ClN3O5 |
|---|---|
| Molecular Weight | 409.86 |
| InChIKey | HYHUBACBCPALHK-UHFFFAOYSA-N |
| SMILES | Cl.NCCCCCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Hazard Codes | Xi |
|---|