UCL-1848 trifluoroacetate salt structure
|
Common Name | UCL-1848 trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 201147-53-7 | Molecular Weight | 766.65100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H35F9N4O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | UCL-1848 trifluoroacetate salt |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H35F9N4O6 |
|---|---|
| Molecular Weight | 766.65100 |
| Exact Mass | 766.24100 |
| PSA | 146.48000 |
| LogP | 6.22290 |
| InChIKey | ULHSSUUXILBBGV-UHFFFAOYSA-N |
| SMILES | O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F.c1ccc2c(c1)c1cc[n+]2CCCCC[n+]2ccc(c3ccccc32)NCCCCCN1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
|
bis-Quinolinium cyclophanes: 8,14-diaza-1,7(1, 4)-diquinolinacyclotetradecaphane (UCL 1848), a highly potent and selective, nonpeptidic blocker of the apamin-sensitive Ca(2+)-activated K(+) channel.
J. Med. Chem. 43 , 3478-3481, (2000)
|
|
|
Therapeutic scope of modulation of non-voltage-gated cation channels.
Drug Discov. Today 10 , 129-137, (2005) Although widely regarded as attractive drug targets, less than a tenth of known ion channels are currently commercially exploited as therapeutic targets. Historically, drug discovery efforts on ion ch... |
| 8,14-Diaza-1,7(1,4)-diquinolinacyclotetradecaphane trifluoroacetate salt |