boc-hyp-obzl structure
|
Common Name | boc-hyp-obzl | ||
|---|---|---|---|---|
| CAS Number | 89813-47-8 | Molecular Weight | 321.368 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 441.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.8±28.7 °C | |
| Name | N-Boc-trans-4-hydroxy-L-proline benzyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.4±45.0 °C at 760 mmHg |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.368 |
| Flash Point | 220.8±28.7 °C |
| Exact Mass | 321.157623 |
| PSA | 76.07000 |
| LogP | 1.56 |
| Appearance of Characters | Liquid | Pale brown |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | BEIPCYKSYYZEJH-KGLIPLIRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(O)CC1C(=O)OCc1ccccc1 |
| Storage condition | 2-8°C |
| 1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(1,1-dimethylethyl) 2-(phenylmethyl) ester, (2S,4R)- |
| Boc-Hyp-OBzl |
| 2-Benzyl 1-(2-methyl-2-propanyl) (2S,4R)-4-hydroxy-1,2-pyrrolidinedicarboxylate |