Propargyl-PEG8-Boc structure
|
Common Name | Propargyl-PEG8-Boc | ||
|---|---|---|---|---|
| CAS Number | 2055014-96-3 | Molecular Weight | 492.600 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 528.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C24H44O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.3±28.8 °C | |
Use of Propargyl-PEG8-BocPropargyl-PEG7-Boc is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
| Name | Propargyl-PEG8-t-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Propargyl-PEG7-Boc is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
[1]. Noah Bell, et al. Compounds and methods for inhibiting phosphate transport. WO2012054110A2. |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 528.4±45.0 °C at 760 mmHg |
| Molecular Formula | C24H44O10 |
| Molecular Weight | 492.600 |
| Flash Point | 220.3±28.8 °C |
| Exact Mass | 492.293457 |
| LogP | -0.54 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.460 |
| InChIKey | IGEMRRCREJIMCQ-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
| 2-Methyl-2-propanyl 4,7,10,13,16,19,22,25-octaoxaoctacos-27-yn-1-oate |
| MFCD28976700 |
| 4,7,10,13,16,19,22,25-Octaoxaoctacos-27-yn-1-oic acid, 1,1-dimethylethyl ester |