Propargyl-PEG8-acid structure
|
Common Name | Propargyl-PEG8-acid | ||
|---|---|---|---|---|
| CAS Number | 2055014-94-1 | Molecular Weight | 436.494 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 531.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H36O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.9±23.6 °C | |
Use of Propargyl-PEG8-acidPropargyl-PEG8-acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). The ADCs can be used in bacterial infections caused by Gram-negative bacteria[1]. |
| Name | Propargyl-PEG8-acid |
|---|---|
| Synonym | More Synonyms |
| Description | Propargyl-PEG8-acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). The ADCs can be used in bacterial infections caused by Gram-negative bacteria[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 531.0±50.0 °C at 760 mmHg |
| Molecular Formula | C20H36O10 |
| Molecular Weight | 436.494 |
| Flash Point | 171.9±23.6 °C |
| Exact Mass | 436.230835 |
| LogP | -2.23 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.469 |
| InChIKey | QZQUQXNQKWZDNM-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
| Hazard Codes | Xi |
|---|
| MFCD28976699 |
| 4,7,10,13,16,19,22,25-Octaoxaoctacos-27-yn-1-oic acid |