Rosuvastatin-d6 (sodium salt) structure
|
Common Name | Rosuvastatin-d6 (sodium salt) | ||
|---|---|---|---|---|
| CAS Number | 2070009-41-3 | Molecular Weight | 509.556 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21D6FN3NaO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Rosuvastatin-d6 (sodium salt)Rosuvastatin-d6 sodium salt is intended for use as an internal standard for the quantification of rosuvastatin by GC- or LC-MS. |
| Name | Rosuvastatin-d6 (sodium salt) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H21D6FN3NaO6S |
|---|---|
| Molecular Weight | 509.556 |
| Exact Mass | 509.187897 |
| InChIKey | RGEBGDYYHAFODH-HPECXWNWSA-M |
| SMILES | CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1C=CC(O)CC(O)CC(=O)[O-].[Na+] |
| Rosuvastatin-d6 (sodium salt) |
| 6-Heptenoic acid, 7-[4-(4-fluorophenyl)-6-[1-(methyl-d3)ethyl-2,2,2-d3]-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl]-3,5-dihydroxy-, sodium salt, (3R,5S,6E)- (1:1) |
| Sodium (3R,5S,6E)-7-{4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-[(1,1,1,3,3,3-2H6)-2-propanyl]-5-pyrimidinyl}-3,5-dihydroxy-6-heptenoate |