Methicillin-d6 sodium salt structure
|
Common Name | Methicillin-d6 sodium salt | ||
|---|---|---|---|---|
| CAS Number | 1356847-96-5 | Molecular Weight | 408.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14D6N2NaO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Methicillin-d6 sodium saltMethicillin-d6 sodium salt is the deuterium labeled Methicillin sodium salt. Methicillin sodium salt is a β-lactam antibiotic which acts by inhibiting penicillin-binding proteins that are involved in the synthesis of peptidoglycan. |
| Name | Methicillin-d6 sodium salt |
|---|
| Description | Methicillin-d6 sodium salt is the deuterium labeled Methicillin sodium salt. Methicillin sodium salt is a β-lactam antibiotic which acts by inhibiting penicillin-binding proteins that are involved in the synthesis of peptidoglycan. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C17H14D6N2NaO6S |
|---|---|
| Molecular Weight | 408.43 |
| InChIKey | MGFZNWDWOKASQZ-IIBJRIMISA-M |
| SMILES | COc1cccc(OC)c1C([O-])=NC1C(=O)N2C1SC(C)(C)C2C(=O)O.[Na+] |