MK-571-d6 sodium salt structure
|
Common Name | MK-571-d6 sodium salt | ||
|---|---|---|---|---|
| CAS Number | 1263184-04-8 | Molecular Weight | 543.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H21D6ClN2NaO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MK-571-d6 sodium saltMK-571-d6 (L-660711-d6) sodium salt is the deuterium labeled MK-571 sodium salt. MK-571 sodium salt is a selective, orally active leukotriene D4 receptor antagonist, with Kis of 0.22 and 2.1 nM in guinea pig and human lung membranes[1][2]. |
| Name | MK-571-d6 sodium salt |
|---|
| Description | MK-571-d6 (L-660711-d6) sodium salt is the deuterium labeled MK-571 sodium salt. MK-571 sodium salt is a selective, orally active leukotriene D4 receptor antagonist, with Kis of 0.22 and 2.1 nM in guinea pig and human lung membranes[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C26H21D6ClN2NaO3S2 |
|---|---|
| Molecular Weight | 543.11 |
| InChIKey | XNAYQOBPAXEYLI-RVVHJAHASA-M |
| SMILES | CN(C)C(=O)CCSC(SCCC(=O)[O-])c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1.[Na+] |