t-Boc-N-Amido-PEG7-propargyl
Modify Date: 2025-08-26 11:42:13
t-Boc-N-Amido-PEG7-propargyl structure
|
Common Name | t-Boc-N-Amido-PEG7-propargyl | ||
|---|---|---|---|---|
| CAS Number | 2112737-90-1 | Molecular Weight | 463.56 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H41NO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of t-Boc-N-Amido-PEG7-propargylBoc-NH-PEG7-propargyl is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Boc-NH-PEG7-propargyl |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-NH-PEG7-propargyl is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C22H41NO9 |
|---|---|
| Molecular Weight | 463.56 |
| InChIKey | KJDMOHBSNFYPKQ-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCOCCNC(=O)OC(C)(C)C |
| MFCD30828698 |