WSQR DR structure
|
Common Name | WSQR DR | ||
|---|---|---|---|---|
| CAS Number | 2113-68-0 | Molecular Weight | 234.271 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H10O3S | Melting Point | 135-138°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-phenylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Melting Point | 135-138°C |
| Molecular Formula | C12H10O3S |
| Molecular Weight | 234.271 |
| Exact Mass | 234.035065 |
| PSA | 62.75000 |
| LogP | 2.14 |
| Index of Refraction | 1.613 |
| InChIKey | XDTYUYVIGLIFCW-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc(-c2ccccc2)cc1 |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2904100000 |
|
~%
WSQR DR CAS#:2113-68-0 |
| Literature: US1981337 , ; |
|
~50%
WSQR DR CAS#:2113-68-0 |
| Literature: Hari, Anitha; Miller, Benjamin L. Organic Letters, 1999 , vol. 1, # 13 p. 2109 - 2111 |
|
~%
WSQR DR CAS#:2113-68-0 |
| Literature: J.Tohoku Coll.Pharm.Chem.Abstr., , # 4 p. 19,24 J.Tohoku Coll.Pharm.Chem.Abstr., , p. 7234 |
|
~%
WSQR DR CAS#:2113-68-0 |
| Literature: Journal of Organic Chemistry USSR (English Translation), , vol. 16, p. 1940 - 1943 Zhurnal Organicheskoi Khimii, , vol. 16, # 11 p. 2278 - 2281 |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-phenylbenzenesulfonyl acid |
| p-Biphenylsulfonic acid |
| 4-biphenylmonosulfonic acid |
| 4-Biphenylsulfonic acid |
| Biphenyl-4-sulfonic acid |
| 4-Sulfobiphenyl |
| [1,1'-Biphenyl]-4-sulfonic acid |
| WSQR DR |
| MFCD00014733 |
| Biphenyl-4-sulfonic acid hydrate |
| biphenyl-4-sulphonic acid |