1,1,3,3-tetraethyl propane-1,1,3,3-tetracarboxylate structure
|
Common Name | 1,1,3,3-tetraethyl propane-1,1,3,3-tetracarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2121-66-6 | Molecular Weight | 332.34600 | |
| Density | 1.142g/cm3 | Boiling Point | 360.1ºC at 760 mmHg | |
| Molecular Formula | C15H24O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.6ºC | |
| Name | tetraethyl propane-1,1,3,3-tetracarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 360.1ºC at 760 mmHg |
| Molecular Formula | C15H24O8 |
| Molecular Weight | 332.34600 |
| Flash Point | 152.6ºC |
| Exact Mass | 332.14700 |
| PSA | 105.20000 |
| LogP | 0.86130 |
| Vapour Pressure | 2.27E-05mmHg at 25°C |
| Index of Refraction | 1.452 |
| InChIKey | KSXISDYTRDNZLB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC(C(=O)OCC)C(=O)OCC)C(=O)OCC |
| HS Code | 2917190090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| diethyl 2,4-carbethoxypentanedioate |
| diethyl 2,4-bis(ethoxycarbonyl)pentanedioate |
| propane-1,1,3,3-tetracarboxylic acid tetraethyl ester |
| tetraethyl 1,1,3,3-propanetetracarboxylate |
| Propan-1,1,3,3-tetracarbonsaeure-tetraaethylester |