2-Bromo-1,3,5-triisopropylbenzene structure
|
Common Name | 2-Bromo-1,3,5-triisopropylbenzene | ||
|---|---|---|---|---|
| CAS Number | 21524-34-5 | Molecular Weight | 283.247 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 296.5±9.0 °C at 760 mmHg | |
| Molecular Formula | C15H23Br | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 125.9±13.1 °C | |
| Name | 2-bromo-1,3,5-tri(propan-2-yl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 296.5±9.0 °C at 760 mmHg |
| Molecular Formula | C15H23Br |
| Molecular Weight | 283.247 |
| Flash Point | 125.9±13.1 °C |
| Exact Mass | 282.098297 |
| LogP | 7.01 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.510 |
| InChIKey | FUMMYHVKFAHQST-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(C)C)c(Br)c(C(C)C)c1 |
| Water Solubility | Slightly miscible with water. |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Bromo-2,4,6-triisopropylbenzene |
| Benzene, 2-bromo-1,3,5-tris(1-methylethyl)- |
| 2-Bromo-1,3,5-triisopropylbenzene |
| 1,3,5-triisopropyl-2-bromobenzene |
| 1-bromo-2,4,6-tri-i-propylbenzene |
| 2,4,6-triisopropylbromobenzene |
| 2,4,6-i-Pr3C6H2Br |
| MFCD00051547 |