Z-Lys-OH structure
|
Common Name | Z-Lys-OH | ||
|---|---|---|---|---|
| CAS Number | 2212-75-1 | Molecular Weight | 280.320 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 497.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H20N2O4 | Melting Point | 226-231 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 254.4±28.7 °C | |
Use of Z-Lys-OHZ-Lys-OH is a lysine derivative[1]. |
| Name | (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Lys-OH is a lysine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 497.0±45.0 °C at 760 mmHg |
| Melting Point | 226-231 °C (dec.)(lit.) |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.320 |
| Flash Point | 254.4±28.7 °C |
| Exact Mass | 280.142303 |
| PSA | 101.65000 |
| LogP | 1.36 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | OJTJKAUNOLVMDX-LBPRGKRZSA-N |
| SMILES | NCCCCC(NC(=O)OCc1ccccc1)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Nanofibrous spongy microspheres enhance odontogenic differentiation of human dental pulp stem cells.
Adv. Healthc. Mater. 4 , 1993-2000, (2015) Dentin regeneration is challenging due to its complicated anatomical structure and the shortage of odontoblasts. In this study, a novel injectable cell carrier, nanofibrous spongy microspheres (NF-SMS... |
|
|
Characterization of Nalpha-benzyloxycarbonyl-L-lysine oxidizing enzyme from Rhodococcus sp. AIU Z-35-1.
J. Biosci. Bioeng. 104(3) , 218-23, (2007) An oxidase catalyzing conversion of N(alpha)-benzyloxycarbonyl-L-lysine (N(alpha)-Z-L-lysine) to N(alpha)-benzyloxycarbonyl-L-aminoadipate-delta-semialdehyde (N(alpha)-Z-L-AASA) was purified from Rhod... |
|
|
The pH dependency of bovine spleen cathepsin B-catalyzed transfer of N alpha-benzyloxycarbonyl-L-lysine from p-nitrophenol to water and dipeptide nucleophiles. Comparisons with papain.
J. Biol. Chem. 258(3) , 1650-5, (1983) Cathepsin B has been shown to catalyze the transfer of the N alpha-benzyloxycarbonyl-L-lysyl residue from the corresponding p-nitrophenyl ester substrate to water and dipeptide nucleophiles. These rea... |
| α-Carbobenzoxy-L-lysine |
| Z-Lys-OH |
| N-α-Benzyloxycarbonyl-L-lysine |
| cbz-l-lysine |
| N-[(Benzyloxy)carbonyl]-L-lysine |
| Nα-Z-L-Lysine |
| N-α-Carbobenzoxy-L-lysine |
| Cbz-Lys-OH |
| e-carbobenzyloxy-L-lysine |
| carbobenzoxy-L-lysine |
| EINECS 218-662-6 |
| Nalpha-Z-L-Lysine |
| CBZ-L-Lys-OH |
| Z-lysine |
| Nalpha-(Carbobenzyloxy)-L-lysine |
| Nalpha-Cbz-L-lysine |
| L-Lysine, N-[(phenylmethoxy)carbonyl]- |
| Nα-(Carbobenzyloxy)-L-lysine |
| N-α-Cbz-L-lysine |
| MFCD00038204 |
| (S)-6-Amino-2-(((benzyloxy)carbonyl)amino)hexanoic acid |
| n-|A-carbobenzoxy-l-lysine |
| Nα-Cbz-L-lysine |
| N(α)-Cbz-L-lysine |
| N2-Cbz-L-lysine |
| Nα-Carbobenzoxy-L-lysine |
| N-Carbobenzoxy-L-lysine |
| N-alpha-Cbz-L-lysine |