Pomalidomide-PEG2-azide structure
|
Common Name | Pomalidomide-PEG2-azide | ||
|---|---|---|---|---|
| CAS Number | 2267306-14-7 | Molecular Weight | 444.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20N6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pomalidomide-PEG2-azidePomalidomide-PEG2-azide is a synthesized E3 ligase ligand-linker conjugate that incorporates the Pomalidomide based cereblon ligand and 2-unit PEG linker used in PROTAC technology[1]. |
| Name | Pomalidomide-PEG2-azide |
|---|
| Description | Pomalidomide-PEG2-azide is a synthesized E3 ligase ligand-linker conjugate that incorporates the Pomalidomide based cereblon ligand and 2-unit PEG linker used in PROTAC technology[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C19H20N6O7 |
|---|---|
| Molecular Weight | 444.40 |
| InChIKey | QMQAWNMGKYQDLT-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCC(=O)Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Storage condition | -20°C |