Pomalidomide-PEG2-Tos structure
|
Common Name | Pomalidomide-PEG2-Tos | ||
|---|---|---|---|---|
| CAS Number | 2599846-07-6 | Molecular Weight | 515.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H25N3O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pomalidomide-PEG2-TosPomalidomide-PEG2-Tos is an E3 ligase ligand-linker conjugates, composed of a cereblon ligand and two-unit PEG linker. |
| Name | Pomalidomide-PEG2-Tos |
|---|
| Description | Pomalidomide-PEG2-Tos is an E3 ligase ligand-linker conjugates, composed of a cereblon ligand and two-unit PEG linker. |
|---|
| Molecular Formula | C24H25N3O8S |
|---|---|
| Molecular Weight | 515.54 |
| InChIKey | PDJTUNUXHWLYAY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| Hazard Codes | Xi |
|---|