Biotin-PEG2-azide structure
|
Common Name | Biotin-PEG2-azide | ||
|---|---|---|---|---|
| CAS Number | 1910803-72-3 | Molecular Weight | 400.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H28N6O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Biotin-PEG2-azideBiotin-PEG2-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | Biotin-PEG2-azide |
|---|
| Description | Biotin-PEG2-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| Molecular Formula | C16H28N6O4S |
|---|---|
| Molecular Weight | 400.5 |
| InChIKey | OVEZMVONEJMGLZ-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| Storage condition | 2-8°C |