3-Benzyloxybenzhydrazide structure
|
Common Name | 3-Benzyloxybenzhydrazide | ||
|---|---|---|---|---|
| CAS Number | 228419-13-4 | Molecular Weight | 242.27300 | |
| Density | 1.201g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O2 | Melting Point | 113ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Benzyloxybenzhydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Melting Point | 113ºC |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.27300 |
| Exact Mass | 242.10600 |
| PSA | 64.35000 |
| LogP | 2.96030 |
| Index of Refraction | 1.61 |
| InChIKey | JKJQCSNZIBXALH-UHFFFAOYSA-N |
| SMILES | NNC(=O)c1cccc(OCc2ccccc2)c1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S36/37/39-S26 |
| HS Code | 2928000090 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-BENZYLOXYBENZHYDRAZIDE |
| 3-phenylmethoxybenzohydrazide |