c-ABL-IN-1 structure
|
Common Name | c-ABL-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 2304918-82-7 | Molecular Weight | 400.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16Cl2FN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of c-ABL-IN-1c-ABL-IN-1 is a novel selective c-Abl inhibitor that prevents neurodegeneration in parkinson’s disease. |
| Name | c-ABL-IN-1 |
|---|
| Description | c-ABL-IN-1 is a novel selective c-Abl inhibitor that prevents neurodegeneration in parkinson’s disease. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H16Cl2FN3OS |
|---|---|
| Molecular Weight | 400.30 |
| InChIKey | CKKZDNADJKPOGH-FZIZHOOBSA-N |
| SMILES | Cc1ccncc1-c1ccc2nc(NC(=O)C3CC3F)sc2c1.Cl.Cl |