1,3,7-Trimethyluric acid structure
|
Common Name | 1,3,7-Trimethyluric acid | ||
|---|---|---|---|---|
| CAS Number | 5415-44-1 | Molecular Weight | 210.190 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 476.7ºC at 760mmHg | |
| Molecular Formula | C8H10N4O3 | Melting Point | ≥300ºC | |
| MSDS | N/A | Flash Point | 242.1ºC | |
Use of 1,3,7-Trimethyluric acid1,3,7-Trimethyluric acid is the metabolite of caffeine. The metabolic ratio 1,3,7-Trimethyluric acid to caffeine can be evaluated as a biomarker to describe variability in CYP3A activity in a cohort[1]. |
| Name | 1,3,7-trimethyluric acid |
|---|---|
| Synonym | More Synonyms |
| Description | 1,3,7-Trimethyluric acid is the metabolite of caffeine. The metabolic ratio 1,3,7-Trimethyluric acid to caffeine can be evaluated as a biomarker to describe variability in CYP3A activity in a cohort[1]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 476.7ºC at 760mmHg |
| Melting Point | ≥300ºC |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.190 |
| Flash Point | 242.1ºC |
| Exact Mass | 210.075287 |
| PSA | 81.79000 |
| LogP | 0.06 |
| Index of Refraction | 1.661 |
| InChIKey | BYXCFUMGEBZDDI-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c([nH]c(=O)n2C)n(C)c1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Uric acid, 1,3,7-trimethyl- (VAN) (8CI) |
| Trimethyluric acid |
| uric acid, 1,3,7-trimethyl- |
| BA 2753 |
| 1,3,7-Trimethyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione |
| 1,3,7-trimethylurate |
| 1,3,7-Trimethyl-harnsaeure |
| 1,3,7-Trimethyluric acid |
| 1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-1,3,7-trimethyl- |
| 2,6,8-Trihydroxy-1,3,7-trimethylpurine |
| 1,3,7-trimethyl-7,9-dihydro-3H-purine-2,6,8-trione |
| 8-oxy-caffeine |
| 1,3,7-trimethyl-9H-purine-2,6,8-trione |
| Trimethyl uric acid |
| Uric acid, 1,3,7-trimethyl- (6CI,7CI,8CI) |