Cas9-IN-3 structure
|
Common Name | Cas9-IN-3 | ||
|---|---|---|---|---|
| CAS Number | 2322051-02-3 | Molecular Weight | 279.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cas9-IN-3Cas9-IN-3 is a potent Cas9 inhibitor (IC50=28 μM). CRISPR/Cas systems have revolutionized gene editing in various species[1]. |
| Name | Cas9-IN-3 |
|---|
| Description | Cas9-IN-3 is a potent Cas9 inhibitor (IC50=28 μM). CRISPR/Cas systems have revolutionized gene editing in various species[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 28 μM (Cas9)[1] |
| References |
| Molecular Formula | C19H21NO |
|---|---|
| Molecular Weight | 279.38 |
| InChIKey | AIJJMOSTONEFEE-UHFFFAOYSA-N |
| SMILES | CC1CCN(C(=O)c2cccc(-c3ccccc3)c2)CC1 |