Pomalidomide-amido-PEG3-C2-NH2 structure
|
Common Name | Pomalidomide-amido-PEG3-C2-NH2 | ||
|---|---|---|---|---|
| CAS Number | 2328070-52-4 | Molecular Weight | 476.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pomalidomide-amido-PEG3-C2-NH2Pomalidomide-amido-PEG3-C2-NH2 (Cereblon Ligand-Linker Conjugates 22) is a synthesized E3 ligase ligand-linker conjugate that incorporates the Pomalidomide based cereblon ligand and 3-unit PEG linker used in PROTAC technology[1]. |
| Name | Pomalidomide-amido-PEG3-C2-NH2 |
|---|
| Description | Pomalidomide-amido-PEG3-C2-NH2 (Cereblon Ligand-Linker Conjugates 22) is a synthesized E3 ligase ligand-linker conjugate that incorporates the Pomalidomide based cereblon ligand and 3-unit PEG linker used in PROTAC technology[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| In Vitro | Pomalidomide-amido-PEG3-C2-NH2 (Compound 5b) can be used to synthesize BI-3663. BI-3663 (cereblon-based) degrades focal adhesion tyrosine kinase (PTK2) with a median DC50 of 30 nM to >80% across a panel of 11 human hepatocellular carcinoma (HCC) cell lines[1]. |
| References |
| Molecular Formula | C22H28N4O8 |
|---|---|
| Molecular Weight | 476.48 |
| InChIKey | FEXCPYUYLOFYGF-UHFFFAOYSA-N |
| SMILES | NCCOCCOCCOCCC(=O)Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Hazard Codes | Xi |
|---|