IDO1-IN-19 structure
|
Common Name | IDO1-IN-19 | ||
|---|---|---|---|---|
| CAS Number | 2328099-11-0 | Molecular Weight | 474.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H22F4N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IDO1-IN-19IDO1-IN-19 (Compound 17) is a potent inhibitor of IDO1. IDO1-IN-19 has the potential for the research of cancer diseases[1]. |
| Name | IDO1-IN-19 |
|---|
| Description | IDO1-IN-19 (Compound 17) is a potent inhibitor of IDO1. IDO1-IN-19 has the potential for the research of cancer diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H22F4N2O3 |
|---|---|
| Molecular Weight | 474.45 |
| InChIKey | ICJRFPZBMMQAPU-UHFFFAOYSA-N |
| SMILES | CC(C)(O)c1cc(C(F)(F)F)ncc1-c1ccc(C2(C(=O)Nc3ccc(F)cc3)COC2)cc1 |