delta7-Avenasterol structure
|
Common Name | delta7-Avenasterol | ||
|---|---|---|---|---|
| CAS Number | 23290-26-8 | Molecular Weight | 412.69100 | |
| Density | 0.98±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C29H48O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of delta7-AvenasterolAvenasterol is a natural sterol isolated from seed oils of Testouri and Jebali cultivars[1]. |
| Name | (3S,5S,10S,13R,14R,17R)-10,13-dimethyl-17-[(Z,2R)-5-propan-2-ylhept-5-en-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Avenasterol is a natural sterol isolated from seed oils of Testouri and Jebali cultivars[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.98±0.1 g/cm3 |
|---|---|
| Molecular Formula | C29H48O |
| Molecular Weight | 412.69100 |
| Exact Mass | 412.37100 |
| PSA | 20.23000 |
| LogP | 7.94490 |
| InChIKey | MCWVPSBQQXUCTB-SLPSUXHFSA-N |
| SMILES | CC=C(CCC(C)C1CCC2C3=CCC4CC(O)CCC4(C)C3CCC21C)C(C)C |
| Storage condition | 2-8°C |
| Water Solubility | Insuluble (1.2E-6 g/L) (25 ºC) |
| Z-24-Ethylidene-5alpha-cholest-7-en-3beta-ol |
| 24Z-Ethylidenelathosterol |
| avenasterol |
| UNII-I0WYR6393O |
| delta7-Avenasterol |