Biphenyl-4,4'-dicarbonyl dichloride structure
|
Common Name | Biphenyl-4,4'-dicarbonyl dichloride | ||
|---|---|---|---|---|
| CAS Number | 2351-37-3 | Molecular Weight | 279.118 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 407.8±38.0 °C at 760 mmHg | |
| Molecular Formula | C14H8Cl2O2 | Melting Point | 189ºC | |
| MSDS | USA | Flash Point | 224.1±22.4 °C | |
| Name | 4-(4-carbonochloridoylphenyl)benzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.8±38.0 °C at 760 mmHg |
| Melting Point | 189ºC |
| Molecular Formula | C14H8Cl2O2 |
| Molecular Weight | 279.118 |
| Flash Point | 224.1±22.4 °C |
| Exact Mass | 277.990143 |
| PSA | 34.14000 |
| LogP | 3.74 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | QDBOAKPEXMMQFO-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc(-c2ccc(C(=O)Cl)cc2)cc1 |
| Hazard Codes | C:Corrosive |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| HS Code | 2917399090 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| biphenyl-4,4'-dicarboxylic acid dichloride |
| Biphenyldicarbonylchloride |
| 4,4'-Diphenyldicarbonyl Chloride |
| (1,1'-Biphenyl)-4,4'-dicarbonyl dichloride |
| 1,1'-biphenyl-4,4'-dicarbonyl chloride |
| Biphenyl-4,4'-dicarbonyl dichloride |
| biphenyl 4,4'-dicarboxylic acid chloride |
| 4,4'-Bibenzoyl Chloride |
| EINECS 219-085-2 |
| 4,4'-BIPHENYLDICARBONYL CHLORIDE |
| 4,4'-Biphenyldicarbonyl dichloride |
| 4,4'-biphenyldicarboxylic acid dichloride |
| [1,1'-Biphenyl]-4,4'-dicarbonyl dichloride |
| 4,4'-Dibenzoyl Chloride |