(S,R,S)-AHPC-C1-NH2 hydrochloride structure
|
Common Name | (S,R,S)-AHPC-C1-NH2 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2361120-26-3 | Molecular Weight | 524.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H34ClN5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (S,R,S)-AHPC-C1-NH2 hydrochloride(S,R,S)-AHPC-C1-NH2 hydrochloride is a synthesized E3 ligase ligand-linker conjugate that incorporates the (S,R,S)-AHPC based VHL ligand and a linker used in PROTAC technology[1]. |
| Name | (S,R,S)-AHPC-C1-NH2 hydrochloride |
|---|
| Description | (S,R,S)-AHPC-C1-NH2 hydrochloride is a synthesized E3 ligase ligand-linker conjugate that incorporates the (S,R,S)-AHPC based VHL ligand and a linker used in PROTAC technology[1]. |
|---|---|
| Related Catalog | |
| Target |
VHL |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[2]. |
| References |
| Molecular Formula | C24H34ClN5O4S |
|---|---|
| Molecular Weight | 524.08 |
| InChIKey | RDVLBRLCBGVZQV-UTYHKCQPSA-N |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)C2CC(O)CN2C(=O)C(NC(=O)CN)C(C)(C)C)cc1.Cl |
| Hazard Codes | Xi |
|---|