Desmorpholinyl Navitoclax-NH-Me
Modify Date: 2025-08-25 07:06:54
Desmorpholinyl Navitoclax-NH-Me structure
|
Common Name | Desmorpholinyl Navitoclax-NH-Me | ||
|---|---|---|---|---|
| CAS Number | 2365172-82-1 | Molecular Weight | 918.55 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C44H51ClF3N5O5S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Desmorpholinyl Navitoclax-NH-MeDesmorpholinyl Navitoclax-NH-Me is a Bcl-xL inhibitor. Desmorpholinyl Navitoclax-NH-Me and a CRBN ligand for the E3 ubiquitin ligase can be used in the synthesis of PROTAC BCL-XL degrader XZ739 (HY-133557)[1][2]. |
| Name | Desmorpholinyl Navitoclax-NH-Me |
|---|
| Description | Desmorpholinyl Navitoclax-NH-Me is a Bcl-xL inhibitor. Desmorpholinyl Navitoclax-NH-Me and a CRBN ligand for the E3 ubiquitin ligase can be used in the synthesis of PROTAC BCL-XL degrader XZ739 (HY-133557)[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C44H51ClF3N5O5S3 |
|---|---|
| Molecular Weight | 918.55 |
| InChIKey | CNTHZPROCQHGOX-PGUFJCEWSA-N |
| SMILES | CNCCC(CSc1ccccc1)Nc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCN(CC4=C(c5ccc(Cl)cc5)CCC(C)(C)C4)CC3)cc2)cc1S(=O)(=O)C(F)(F)F |
| Hazard Codes | Xi |
|---|