Ferroptosis inducer-1 structure
|
Common Name | Ferroptosis inducer-1 | ||
|---|---|---|---|---|
| CAS Number | 2375357-96-1 | Molecular Weight | 464.90 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H21ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ferroptosis inducer-1Ferroptosis inducer-1 (compound BX-3a) is a Ferroptosis inducer with antitumor potential[1]. |
| Name | Ferroptosis inducer-1 |
|---|
| Description | Ferroptosis inducer-1 (compound BX-3a) is a Ferroptosis inducer with antitumor potential[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H21ClN2O5 |
|---|---|
| Molecular Weight | 464.90 |
| InChIKey | AEFRDVDAQLIGSO-OFNKIYASSA-N |
| SMILES | C#CCOC(=O)c1ccc(C2c3[nH]c4ccccc4c3CC(C(=O)OC)N2C(=O)CCl)cc1 |