(±)-1,2-Diolein structure
|
Common Name | (±)-1,2-Diolein | ||
|---|---|---|---|---|
| CAS Number | 2442-61-7 | Molecular Weight | 620.99 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 670.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C39H72O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 186.3±19.4 °C | |
Use of (±)-1,2-Diolein(±)-1,2-Diolein (1,2-Dioleoyl-rac-glycerol) is a PKC activator[1]. |
| Name | 1,2-dioleoylglycerol |
|---|---|
| Synonym | More Synonyms |
| Description | (±)-1,2-Diolein (1,2-Dioleoyl-rac-glycerol) is a PKC activator[1]. |
|---|---|
| Related Catalog | |
| In Vitro | 1,2-Diolein (50 μM; 5 min) increases Ca2+ influx significantly[1]. 1,2-Diolein (50 μM; 5 min) induces PKC activity of myoblasts cells[1]. Western Blot Analysis[1] Cell Line: myoblasts cells Concentration: 50 μM Incubation Time: 5 min Result: Induced PKC activity. |
| References |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 670.8±35.0 °C at 760 mmHg |
| Molecular Formula | C39H72O5 |
| Molecular Weight | 620.99 |
| Flash Point | 186.3±19.4 °C |
| Exact Mass | 620.537964 |
| PSA | 72.83000 |
| LogP | 15.43 |
| Vapour Pressure | 0.0±4.7 mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | AFSHUZFNMVJNKX-CLFAGFIQSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCCC=CCCCCCCCC |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn: Harmful;F: Flammable; |
| Risk Phrases | R11 |
| Safety Phrases | 36/37 |
| RIDADR | UN 1282 3 |
|
Simultaneous detection of phosphatidylcholines and glycerolipids using matrix-enhanced surface-assisted laser desorption/ionization-mass spectrometry with sputter-deposited platinum film.
J. Mass Spectrom. 50 , 1264-9, (2015) Matrix-assisted laser desorption/ionisation (MALDI) imaging mass spectrometry (IMS) allows for the simultaneous detection and imaging of several molecules in brain tissue. However, the detection of gl... |
| 1,2-Dioleoyl-DL-glycerol |
| rac-Glycerol 1,2-dioleate |
| 1,2-Diolein |
| rac-1,2-Dioleoylglycerol |
| 3-Hydroxypropane-1,2-diyl (9Z,9'Z)bis-octadec-9-enoate |
| GLYCEROL DIOLEATE |
| 9-Octadecenoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester, (9Z,9'Z)- |
| 3-hydroxy-1,2-propanediyl dioleate |
| 1,2-Di(cis-9-octadecenoyl)-rac-glycerol |
| (±)-1,2-Dioleoylglycerol |
| DIOLEOYL-RAC-GLYCEROL |
| 1,2-dioleoyl glycerol ester |
| [3-hydroxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
| cis-1,2-dioleoyl-rac-glycerol |
| UNII:ADK3G923Z3 |
| 1,2-Dioleoyl-rac-glycerol |
| (±)-1,2-Diolein |
| (9Z)-9-Octadecenoic acid |
| 1,2-Dioleoylglycerol |
| 3-Hydroxy-1,2-propanediyl (9Z,9'Z)bis(-9-octadecenoate) |