N-(6-Bromohexyl)phthalimide structure
|
Common Name | N-(6-Bromohexyl)phthalimide | ||
|---|---|---|---|---|
| CAS Number | 24566-79-8 | Molecular Weight | 310.18600 | |
| Density | 1.414 g/cm3 | Boiling Point | 186-188°C 0,4mm | |
| Molecular Formula | C14H16BrNO2 | Melting Point | 55 °C | |
| MSDS | N/A | Flash Point | 186-188°C/0.4mm | |
| Name | 2-(6-bromohexyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.414 g/cm3 |
|---|---|
| Boiling Point | 186-188°C 0,4mm |
| Melting Point | 55 °C |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.18600 |
| Flash Point | 186-188°C/0.4mm |
| Exact Mass | 309.03600 |
| PSA | 37.38000 |
| LogP | 3.17580 |
| Vapour Pressure | 8.93E-07mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | OAZFTIPKNPTDIO-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCBr |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 6-Phthalimido-1-bromohexane |
| N-(6-Bromohexyl)phthalimide |
| MFCD00023098 |