Pom-8PEG structure
|
Common Name | Pom-8PEG | ||
|---|---|---|---|---|
| CAS Number | 2488761-03-9 | Molecular Weight | 625.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H43N3O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pom-8PEGPom-8PEG, an E3 ligase ligand-linker conjugate, incorporates a cereblon (CRBN) ligand for the E3 ubiquitin ligase and an 8-unit PEG linker. Pom-8PEG can be used in the synthesis of PROTAC, such as IDO1 PROTAC degrader[1]. |
| Name | Pom-8PEG |
|---|
| Description | Pom-8PEG, an E3 ligase ligand-linker conjugate, incorporates a cereblon (CRBN) ligand for the E3 ubiquitin ligase and an 8-unit PEG linker. Pom-8PEG can be used in the synthesis of PROTAC, such as IDO1 PROTAC degrader[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| References |
| Molecular Formula | C29H43N3O12 |
|---|---|
| Molecular Weight | 625.66 |
| InChIKey | QJYUIYBXSCIRAP-UHFFFAOYSA-N |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCOCCOCCOCCOCCOCCOCCOCCO)c3C2=O)C(=O)N1 |
| Hazard Codes | Xi |
|---|