N,N,N-Triethylethanaminium perchlorate structure
|
Common Name | N,N,N-Triethylethanaminium perchlorate | ||
|---|---|---|---|---|
| CAS Number | 2567-83-1 | Molecular Weight | 229.702 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H20ClNO4 | Melting Point | >300°C | |
| MSDS | N/A | Flash Point | N/A | |
Use of N,N,N-Triethylethanaminium perchlorateTetraethylammonium Perchlorate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | tetraethylazanium,perchlorate |
|---|---|
| Synonym | More Synonyms |
| Description | Tetraethylammonium Perchlorate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Melting Point | >300°C |
|---|---|
| Molecular Formula | C8H20ClNO4 |
| Molecular Weight | 229.702 |
| Exact Mass | 229.108093 |
| PSA | 74.27000 |
| LogP | 2.09710 |
| InChIKey | WGHUNMFFLAMBJD-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CC.[O-][Cl+3]([O-])([O-])[O-] |
| Hazard Codes | Xi: Irritant;O: Oxidizing agent; |
|---|---|
| Risk Phrases | R5;R8;R36/37/38 |
| Safety Phrases | S47-S37/39-S26-S17-S36 |
| RIDADR | 1479 |
| Packaging Group | II |
| Hazard Class | 5.1 |
| HS Code | 2923900090 |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N,N,N-Triethylethanaminium perchlorate |
| TetraethylaMMoniuM Perchlorate |
| Et4N(perchlorate) |
| Ethanaminium,N,N,N-triethyl-,perchlorate |
| tetraethylazanium perchlorate |
| MFCD00041977 |
| EINECS 219-904-3 |
| tetraethylammonium,perchlorate |