PROTAC PARP/EGFR ligand 1 structure
|
Common Name | PROTAC PARP/EGFR ligand 1 | ||
|---|---|---|---|---|
| CAS Number | 2661609-57-8 | Molecular Weight | 1020.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C53H56ClF2N9O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PROTAC PARP/EGFR ligand 1PROTAC PARP/EGFR ligand 1 is an active compound that can be used for the synthesis of dual PARP EGFR degraders by proteolytic targeting chimera (PROTAC) technology[1]. |
| Name | PROTAC PARP/EGFR ligand 1 |
|---|
| Description | PROTAC PARP/EGFR ligand 1 is an active compound that can be used for the synthesis of dual PARP EGFR degraders by proteolytic targeting chimera (PROTAC) technology[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C53H56ClF2N9O8 |
|---|---|
| Molecular Weight | 1020.52 |
| InChIKey | BNDSNLWRYZUWNY-GWHBCOKCSA-N |
| SMILES | C#CCOCC(NC(=O)CCCCCOc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC)C(=O)NCCCCCC(=O)N1CCN(C(=O)c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)CC1 |