EPZ-719 structure
|
Common Name | EPZ-719 | ||
|---|---|---|---|---|
| CAS Number | 2697176-16-0 | Molecular Weight | 450.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H31FN4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of EPZ-719EPZ-719 is a novel and potent SETD2 inhibitor ( IC50 = 0.005 μM) with a high selectivity over other histone methyltransferases. |
| Name | EPZ-719 |
|---|
| Description | EPZ-719 is a novel and potent SETD2 inhibitor ( IC50 = 0.005 μM) with a high selectivity over other histone methyltransferases. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H31FN4O3S |
|---|---|
| Molecular Weight | 450.57 |
| InChIKey | ZLVKIBLQXFILMA-IKGGRYGDSA-N |
| SMILES | Cc1ccc(F)c2cc(C(=O)NC3CCCC(N4CCC(N(C)S(C)(=O)=O)C4)C3)[nH]c12 |