Phenol,4-[2-(4-iodophenyl)diazenyl]- structure
|
Common Name | Phenol,4-[2-(4-iodophenyl)diazenyl]- | ||
|---|---|---|---|---|
| CAS Number | 2703-28-8 | Molecular Weight | 324.11700 | |
| Density | 1.67g/cm3 | Boiling Point | 389.5ºC at 760 mmHg | |
| Molecular Formula | C12H9IN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.4ºC | |
| Name | 4-[(4-iodophenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 389.5ºC at 760 mmHg |
| Molecular Formula | C12H9IN2O |
| Molecular Weight | 324.11700 |
| Flash Point | 189.4ºC |
| Exact Mass | 323.97600 |
| PSA | 44.95000 |
| LogP | 4.41220 |
| Vapour Pressure | 2.83E-06mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | BZPHNHJBAKICSX-UHFFFAOYSA-N |
| SMILES | Oc1ccc(N=Nc2ccc(I)cc2)cc1 |
|
~81%
Phenol,4-[2-(4-... CAS#:2703-28-8 |
| Literature: Leriche, Geoffray; Budin, Ghyslain; Brino, Laurent; Wagner, Alain European Journal of Organic Chemistry, 2010 , # 23 p. 4360 - 4364 |
|
~%
Phenol,4-[2-(4-... CAS#:2703-28-8 |
| Literature: Chattaway; Constable Journal of the Chemical Society, 1914 , vol. 105, p. 127 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4'-Jod-4-oxy-azobenzol |
| 4'-Iod-4-hydroxyazobenzol |