Ethyl chloro[(4-methoxyphenyl)hydrazono]acetate structure
|
Common Name | Ethyl chloro[(4-methoxyphenyl)hydrazono]acetate | ||
|---|---|---|---|---|
| CAS Number | 27143-07-3 | Molecular Weight | 256.685 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 349.0±44.0 °C at 760 mmHg | |
| Molecular Formula | C11H13ClN2O3 | Melting Point | 94ºC | |
| MSDS | N/A | Flash Point | 164.8±28.4 °C | |
| Name | ethyl (2Z)-2-chloro-2-[(4-methoxyphenyl)hydrazinylidene]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 349.0±44.0 °C at 760 mmHg |
| Melting Point | 94ºC |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.685 |
| Flash Point | 164.8±28.4 °C |
| Exact Mass | 256.061462 |
| PSA | 59.92000 |
| LogP | 3.17 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | ATNPZEGMKLGIFA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cl)=NNc1ccc(OC)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2928000090 |
|
~%
Ethyl chloro[(4... CAS#:27143-07-3 |
| Literature: Synthesis, , # 11 p. 1799 - 1803 |
|
~%
Ethyl chloro[(4... CAS#:27143-07-3 |
| Literature: US2006/69258 A1, ; Page/Page column 11-12 ; |
|
~%
Ethyl chloro[(4... CAS#:27143-07-3 |
| Literature: Farmaco, Edizione Scientifica, , vol. 40, # 4 p. 259 - 271 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| ethyl [(4-methoxyphenyl)hydrazono]chloroacetate |
| Ethyl (2Z)-chloro[(4-methoxyphenyl)hydrazono]acetate |
| ethyl chloro(p-methoxyphenylhydrazono)acetate |
| ethyl2-chloro-2-(2-(4-methoxyphenyl)hydrazono)acetate |
| Acetic acid, 2-chloro-2-[2-(4-methoxyphenyl)hydrazinylidene]-, ethyl ester, (2Z)- |
| chloro-(4-methoxy-phenylhydrazono)-acetic acid ethyl ester |
| (Z)-Ethyl 2-chloro-2-(2-(4-methoxyphenyl)hydrazono)acetate |
| Ethyl chloro[(4-methoxyphenyl)hydrazono]acetate |
| Acetic acid,2-chloro-2-[2-(4-methoxyphenyl)hydrazinylidene],ethyl ester |
| ethyl 2-chloro-2-[(4-methoxyphenyl)hydrazinylidene]acetate |
| Acetic acid, 2-chloro-2-[2-(4-methoxyphenyl)hydrazinylidene], ethyl ester |