HBV-IN-10 structure
|
Common Name | HBV-IN-10 | ||
|---|---|---|---|---|
| CAS Number | 2716907-16-1 | Molecular Weight | 433.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24FN7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HBV-IN-10HBV-IN-10 is an enantiomer of compound 6 (WO2021204258A1). Compound 6 is a hepatitis B surface antigen (HBsAg) inhibitor (0.001 μM< EC50 ≤0.05 μM). From patent WO2021204258A1, compound 6[1]. |
| Name | HBV-IN-10 |
|---|
| Description | HBV-IN-10 is an enantiomer of compound 6 (WO2021204258A1). Compound 6 is a hepatitis B surface antigen (HBsAg) inhibitor (0.001 μM< EC50 ≤0.05 μM). From patent WO2021204258A1, compound 6[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Azabicyclo compound as hepatitis b surface antigen inhibitor. WO2021204252A1. |
| Molecular Formula | C23H24FN7O |
|---|---|
| Molecular Weight | 433.48 |
| InChIKey | QSALRAHTLYHGOT-BZELLKQSSA-N |
| SMILES | COC1CCN(c2cc(F)nc(N3C4CCC3c3cnc(-c5ncccn5)nc3C4)c2)C1 |