fthalide structure
|
Common Name | fthalide | ||
|---|---|---|---|---|
| CAS Number | 27355-22-2 | Molecular Weight | 271.912 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 464.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C8H2Cl4O2 | Melting Point | 209-210ºC | |
| MSDS | Chinese | Flash Point | 215.8±27.7 °C | |
| Name | 4,5,6,7-tetrachloro-2-benzofuran-1(3H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 464.4±45.0 °C at 760 mmHg |
| Melting Point | 209-210ºC |
| Molecular Formula | C8H2Cl4O2 |
| Molecular Weight | 271.912 |
| Flash Point | 215.8±27.7 °C |
| Exact Mass | 269.880890 |
| PSA | 26.30000 |
| LogP | 2.73 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | NMWKWBPNKPGATC-UHFFFAOYSA-N |
| SMILES | O=C1OCc2c(Cl)c(Cl)c(Cl)c(Cl)c21 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36-S24/25 |
| WGK Germany | 3 |
| HS Code | 2932209013 |
|
~87%
fthalide CAS#:27355-22-2 |
| Literature: Narasimhan, Srinivasan Heterocycles, 1982 , vol. 18, p. 131 - 135 |
|
~%
fthalide CAS#:27355-22-2 |
| Literature: Graebe Justus Liebigs Annalen der Chemie, 1887 , vol. 238, p. 326,327 Chemische Berichte, 1883 , vol. 16, p. 861 |
|
~%
fthalide CAS#:27355-22-2 |
| Literature: Parrini Gazzetta Chimica Italiana, 1957 , vol. 87, p. 1147,1156 |
|
~%
fthalide CAS#:27355-22-2 |
| Literature: Parrini Gazzetta Chimica Italiana, 1957 , vol. 87, p. 1147,1156 |
|
~%
fthalide CAS#:27355-22-2 |
| Literature: Graebe Justus Liebigs Annalen der Chemie, 1887 , vol. 238, p. 326,327 Chemische Berichte, 1883 , vol. 16, p. 861 |
| HS Code | 2932209013 |
|---|---|
| Summary | 2932209013 4,5,6,7-tetrachloroisobenzofuran-1(3h)-one。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:0.0%。MFN tarrif:6.5%。general tariff:20.0% |
| 4,5,6,7-TETRACHLORO-PHTHALIDE |
| Rabcide |
| 1(3H)-4,5,6,7-tetrachloroisobenzofuranone |
| EINECS 229-405-2 |
| fthalide |
| Phthalide,4,5,6,7-tetrachloro |
| 4,5,6,7-Tetrachloro-1(3H)-isobenzofuranone (9CI) |
| phthalide |
| 1(3H)-Isobenzofuranone, 4,5,6,7-tetrachloro- |
| 4,5,6,7-Tetrachloro-2-benzofuran-1(3H)-one |
| KF-32 |
| PHH |
| 4,5,6,7-tetrachloroisobenzofuran-1(3H)-one |
| 4,5,6,7-tetrachloro-1(3H)-isobenzofuranone |
| 4,5,6,7-tetrachloro-3H-2-benzofuran-1-one |
| 4,5,6,7-Tetrachlor-phthalid |