N-[(4-nitrophenyl)methylideneamino]aniline structure
|
Common Name | N-[(4-nitrophenyl)methylideneamino]aniline | ||
|---|---|---|---|---|
| CAS Number | 2829-27-8 | Molecular Weight | 241.24500 | |
| Density | 1.2g/cm3 | Boiling Point | 408ºC at 760 mmHg | |
| Molecular Formula | C13H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.6ºC | |
| Name | N-[(4-nitrophenyl)methylideneamino]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 408ºC at 760 mmHg |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.24500 |
| Flash Point | 200.6ºC |
| Exact Mass | 241.08500 |
| PSA | 70.21000 |
| LogP | 3.63700 |
| Vapour Pressure | 7.23E-07mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | IXMQSJMHAYPXSV-UVTDQMKNSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=NNc2ccccc2)cc1 |
| Precursor 7 | |
|---|---|
| DownStream 7 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4-nitrobenzaldehyde N-phenylhydrazone |
| 4-Nitro-benzaldehyd-phenylhydrazon |
| 4-nitro-benzaldehyde phenylhydrazone |
| 4-nitrobenzylidene phenylhydrazine |
| p-nitro-benzaldehyde phenylhydrazone |