ETHYL 4-METHOXYBENZOYLACETATE structure
|
Common Name | ETHYL 4-METHOXYBENZOYLACETATE | ||
|---|---|---|---|---|
| CAS Number | 2881-83-6 | Molecular Weight | 222.237 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 330.0±17.0 °C at 760 mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 144.4±21.0 °C | |
| Name | ethyl 3-(4-methoxyphenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 330.0±17.0 °C at 760 mmHg |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.237 |
| Flash Point | 144.4±21.0 °C |
| Exact Mass | 222.089203 |
| PSA | 52.60000 |
| LogP | 1.95 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | KRAHENMBSVAAHD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1ccc(OC)cc1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Glycerol as a sustainable solvent for green chemistry. Gu Y and Jérôme F.
Green Chem. 12(7) , 1127-1138, (2010)
|
|
|
Modified Coumarins. 8. Synthesis of Substituted 5-(4-Methoxyphenyl)-7H-furo [3, 2-g] chromen-7-ones. Garazd MM, et al.
Chem. Nat. Cpds. 38(6) , 539-548, (2002)
|
| 3-(4-Methoxyphenyl)-3-oxopropionic Acid Ethyl Ester |
| Ethyl p-Anisoylacetate |
| Acetic acid, p-anisoyl-, ethyl ester |
| EINECS 220-733-1 |
| p-Anisoylacetic Acid Ethyl Ester |
| MFCD00449636 |
| Ethyl 3-(4-methoxyphenyl)-3-oxo-propanoate |
| 3-(4-methoxy-phenyl)-3-oxo-propionic acid ethyl ester |
| 2-(p-Methoxybenzoyl)acetic acid ethyl ester |
| Ethyl (p-methoxybenzoyl)acetate |
| Ethyl 3-(4-methoxyphenyl)-3-oxopropanoate |
| 3-oxo-3-(4-methoxyphenyl)propanoic acid ethyl ester |
| Ethyl 3-(4-Methoxyphenyl)-3-oxopropionate |
| ETHYL 4-METHOXYBENZOYLACETATE |
| Ethyl (4-methoxybenzoyl)acetate |
| Benzenepropanoic acid, 4-methoxy-β-oxo-, ethyl ester |
| (4-Methoxybenzoyl)acetic acid,ethyl ester |
| (4-Methoxybenzoyl)acetic Acid Ethyl Ester |