Biotin-PEG3-alcohol structure
|
Common Name | Biotin-PEG3-alcohol | ||
|---|---|---|---|---|
| CAS Number | 289714-02-9 | Molecular Weight | 375.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H29N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Biotin-PEG3-alcoholBiotin-PEG3-alcohol is a PEG-based PROTAC linker can be used in the synthesis of PROTAC. |
| Name | Biotin-PEG3-alcohol |
|---|
| Description | Biotin-PEG3-alcohol is a PEG-based PROTAC linker can be used in the synthesis of PROTAC. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| Molecular Formula | C16H29N3O5S |
|---|---|
| Molecular Weight | 375.48 |
| InChIKey | JMPJDHGWKSPEEE-YDHLFZDLSA-N |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCOCCOCCO |