CN 11-2936 structure
|
Common Name | CN 11-2936 | ||
|---|---|---|---|---|
| CAS Number | 29091-21-2 | Molecular Weight | 350.294 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 433.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H17F3N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.7±28.7 °C | |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | prodiamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 433.0±45.0 °C at 760 mmHg |
| Molecular Formula | C13H17F3N4O4 |
| Molecular Weight | 350.294 |
| Flash Point | 215.7±28.7 °C |
| Exact Mass | 350.120178 |
| PSA | 120.90000 |
| LogP | 6.92 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | RSVPPPHXAASNOL-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)c1c([N+](=O)[O-])cc(C(F)(F)F)c(N)c1[N+](=O)[O-] |
| Storage condition | 0-6°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H304-H315-H336-H410 |
| Precautionary Statements | P210-P261-P273-P301 + P310-P331-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | F:Flammable;Xn:Harmful;N:Dangerousfortheenvironment; |
| Risk Phrases | R11;R38;R50/53;R65;R67 |
| Safety Phrases | S60-S61-S62 |
| RIDADR | UN 1145 |
| HS Code | 2921590090 |
|
~%
CN 11-2936 CAS#:29091-21-2 |
| Literature: Endeshaw, Molla M.; Li, Catherine; Leon, Jessica De; Yao, Ni; Latibeaudiere, Kirk; Premalatha, Kokku; Morrissette, Naomi; Werbovetz, Karl A. Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 17 p. 5179 - 5183 |
|
~%
CN 11-2936 CAS#:29091-21-2 |
| Literature: US Borax Patent: DE2013509 , 1970 ; Chem.Abstr., 1970 , vol. 73, # 120287 Full Text Show Details US Borax and Chem. Corp. Patent: US3903078 , 1975 ; Chem.Abstr., 1976 , vol. 84, # 43581 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,6-dinitro-N1,N1-dipropyl-4-(trifluoromethyl)benzene-1,3-diamine |
| 5-dipropylamino-α,α,α-trifluoro-4,6-dinitro-o-toluidine |
| 2,4-Dinitro-N3,N3-dipropyl-6-(trifluoromethyl)-1,3-benzenediamine (9CI) |
| endurance |
| 1,3-Diamino-N1,N |
| KUSABLOCK |
| 2,6-Dinitro-N,N-dipropyl-4-(trifluoromethyl)benzene-1,3-diamine |
| blockade |
| a,a,a-Trifluoro-3,5-dinitro-N4,N4-dipropyltoluene-2,4-diamine |
| Prodiamine |
| 2,6-Dinitro-N,N-dipropyl-4-(trifluormethyl)benzol-1,3-diamin |
| Toluene-2,4-diamine, α,α,α-trifluoro-3,5-dinitro-N4,N4-dipropyl- |
| EINECS 249-421-3 |
| 5-Dipropylamino-a,a,a-trifluoro-1,6-dinitro-o-toluidine |
| N3,N3-Di-n-propyl-2,4-dinitro-6-trifluoromethyl-1,3-phenylenediamine |
| USB-3153 |
| N-bis-(n-propyl)-2,6-dinitro-3-amino-4-trifluoromethylaniline |
| α,α,α-Trifluoro-3,5-dinitro-N4,N4-dipropyltoluene-2,4-diamine (8CI) |
| 2,6-dinitro-N1,N1-dipropyl-4-(trifluoromethyl)-1,3-benzenediamine |
| BARRICADE |
| N1,N1-dipropyl-2,6-dinitro-4-(trifluoromethyl)-1,3-benzenediamine |
| 1,3-Benzenediamine, 2,4-dinitro-N3,N3-dipropyl-6-(trifluoromethyl)- |
| 2,4-dinitro-N3,N3-dipropyl-6-(trifluoromethyl)-1,3-benzenediamine |
| 2,6-dinitro-N1,N1-dipropyl-4-trifluoromethyl-m-phenylenediamine |
| 1,3-benzenediamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- |
| CN-11-2936 |
| 2,6-Dinitro-N,N-dipropyl-4-(trifluoromethyl)-1,3-benzenediamine |
| 2,4-dinitro-N',N'-dipropyl-6-(trifluoromethyl)benzene-1,3-diamine |
| MFCD00274604 |
| CN 11-2936 |
| Marathon |