CL-82198 structure
|
Common Name | CL-82198 | ||
|---|---|---|---|---|
| CAS Number | 307002-71-7 | Molecular Weight | 302.37 | |
| Density | N/A | Boiling Point | 537.1ºC at 760 mmHg | |
| Molecular Formula | C17H22N2O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 278.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of CL-82198CL-82198 is a selective inhibitor of MMP-13.In vitro: In the presence of 10 and 20 μM of the specific MMP-13 inhibitor, CL-82198, migration of the LS174 cells was significantly reduced by 55 and 52%, respectively. . CL-82198 binds to the S1' pocket of MMP-13 leading to 89% enzyme inhibition at a concentration of 10 μg/ml. The addition of the specific MMP-13 inhibitor CL-82198 at a concentration of 10 μM resulted in a 45±5.6% reduction in the migration of LS174 cells. |
| Name | N-(4-morpholin-4-ylbutyl)-1-benzofuran-2-carboxamide,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | CL-82198 is a selective inhibitor of MMP-13.In vitro: In the presence of 10 and 20 μM of the specific MMP-13 inhibitor, CL-82198, migration of the LS174 cells was significantly reduced by 55 and 52%, respectively. . CL-82198 binds to the S1' pocket of MMP-13 leading to 89% enzyme inhibition at a concentration of 10 μg/ml. The addition of the specific MMP-13 inhibitor CL-82198 at a concentration of 10 μM resulted in a 45±5.6% reduction in the migration of LS174 cells. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 537.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 |
| Flash Point | 278.6ºC |
| PSA | 54.71000 |
| LogP | 3.40580 |
| InChIKey | KUJQEQAVMNFFAO-UHFFFAOYSA-N |
| SMILES | O=C(NCCCCN1CCOCC1)c1cc2ccccc2o1 |
| Storage condition | 2-8℃ |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| IN1376 |
| N-[4-(4-Morpholinyl)butyl]-2-benzofurancarboxamide |
| CL-82198 |